C24H34FIN4O3 — CID 111298194
2-[[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide (PubChem CID 111298194) has the molecular formula C24H34FIN4O3 and a molecular weight of 572.46 g/mol. Its IUPAC name is 2-[[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide.
| Compound Name | 2-[[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111298194 |
| Molecular Formula | C24H34FIN4O3 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[[[N-[1-(3,4-diethoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
| SMILES | CCOc1ccc(C(C)N/C(=N/C)NCC(Cc2ccc(F)cc2)C(N)=O)cc1OCC.I |
| InChI | InChI=1S/C24H33FN4O3.HI/c1-5-31-21-12-9-18(14-22(21)32-6-2)16(3)29-24(27-4)28-15-19(23(26)30)13-17-7-10-20(25)11-8-17;/h7-12,14,16,19H,5-6,13,15H2,1-4H3,(H2,26,30)(H2,27,28,29);1H |
| InChIKey | DVJPYXWSSJSUFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|