C22H30IN5O3 — CID 111300370
2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 111300370) has the molecular formula C22H30IN5O3 and a molecular weight of 539.42 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111300370 |
| Molecular Formula | C22H30IN5O3 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\NCC)N2CCN(C(=O)C3CCCO3)CC2)c1.I |
| InChI | InChI=1S/C22H29N5O3.HI/c1-3-17-7-5-8-18(15-17)25-20(28)16-24-22(23-4-2)27-12-10-26(11-13-27)21(29)19-9-6-14-30-19;/h1,5,7-8,15,19H,4,6,9-14,16H2,2H3,(H,23,24)(H,25,28);1H |
| InChIKey | FKSMITKMPBAAAR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|