C22H34IN5O4 — CID 111301724
N-[3-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 111301724) has the molecular formula C22H34IN5O4 and a molecular weight of 559.45 g/mol. Its IUPAC name is N-[3-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111301724 |
| Molecular Formula | C22H34IN5O4 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | N-[3-[2-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCOc1cccc(NC(C)=O)c1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C22H33N5O4.HI/c1-3-23-22(24-9-15-30-19-7-4-6-18(16-19)25-17(2)28)27-12-10-26(11-13-27)21(29)20-8-5-14-31-20;/h4,6-7,16,20H,3,5,8-15H2,1-2H3,(H,23,24)(H,25,28);1H |
| InChIKey | MWDWHOZXFJQZEJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|