C21H32IN5O4 — CID 111300978
N-[3-[2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 111300978) has the molecular formula C21H32IN5O4 and a molecular weight of 545.42 g/mol. Its IUPAC name is N-[3-[2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111300978 |
| Molecular Formula | C21H32IN5O4 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-[3-[2-[[N-methyl-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCOc1cccc(NC(C)=O)c1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C21H31N5O4.HI/c1-16(27)24-17-5-3-6-18(15-17)29-14-8-23-21(22-2)26-11-9-25(10-12-26)20(28)19-7-4-13-30-19;/h3,5-6,15,19H,4,7-14H2,1-2H3,(H,22,23)(H,24,27);1H |
| InChIKey | UAFQKFAHMKWYIV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|