C16H18O3S — CID 11130039
3-(benzenesulfinyl)spiro[4.5]decane-4,10-dione (PubChem CID 11130039) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-(benzenesulfinyl)spiro[4.5]decane-4,10-dione.
| Compound Name | 3-(benzenesulfinyl)spiro[4.5]decane-4,10-dione |
|---|---|
| PubChem CID | 11130039 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-(benzenesulfinyl)spiro[4.5]decane-4,10-dione |
| SMILES | O=C1CCCCC12CCC(S(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C16H18O3S/c17-14-8-4-5-10-16(14)11-9-13(15(16)18)20(19)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2 |
| InChIKey | IANREIRYQAFRDD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|