C13H15NO — CID 135031754
(2S,3R)-2-phenyl-1-azaspiro[2.5]octan-4-one (PubChem CID 135031754) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (2S,3R)-2-phenyl-1-azaspiro[2.5]octan-4-one.
| Compound Name | (2S,3R)-2-phenyl-1-azaspiro[2.5]octan-4-one |
|---|---|
| PubChem CID | 135031754 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (2S,3R)-2-phenyl-1-azaspiro[2.5]octan-4-one |
| SMILES | O=C1CCCC[C@]12N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C13H15NO/c15-11-8-4-5-9-13(11)12(14-13)10-6-2-1-3-7-10/h1-3,6-7,12,14H,4-5,8-9H2/t12-,13-/m0/s1 |
| InChIKey | VTQWBMAIOWTIKJ-STQMWFEESA-N |
| XLogP | 2.21 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|