C17H31N5O3 — CID 111301765
3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111301765) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111301765 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C17H31N5O3/c1-4-19-16(20-12-17(2,3)15(18)24)22-9-7-21(8-10-22)14(23)13-6-5-11-25-13/h13H,4-12H2,1-3H3,(H2,18,24)(H,19,20) |
| InChIKey | ROLOKOLXYRLWMH-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|