C21H32N6O3 — CID 111302619
3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 111302619) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111302619 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 3-[[ethylamino-[4-(oxolane-2-carbonyl)piperazin-1-yl]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(C)n1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H32N6O3/c1-3-22-21(23-10-9-19(28)25-18-8-4-6-16(2)24-18)27-13-11-26(12-14-27)20(29)17-7-5-15-30-17/h4,6,8,17H,3,5,7,9-15H2,1-2H3,(H,22,23)(H,24,25,28) |
| InChIKey | UEAACJXWZSINEP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|