C18H32O2Si — CID 11130649
1-[(1aS,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydrocyclopropa[i]inden-1a-yl]ethanone (PubChem CID 11130649) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is 1-[(1aS,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydrocyclopropa[i]inden-1a-yl]ethanone.
| Compound Name | 1-[(1aS,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydrocyclopropa[i]inden-1a-yl]ethanone |
|---|---|
| PubChem CID | 11130649 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-[(1aS,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydrocyclopropa[i]inden-1a-yl]ethanone |
| SMILES | CC(=O)[C@]12CC[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]31C2 |
| InChI | InChI=1S/C18H32O2Si/c1-13(19)17-11-9-14-15(8-7-10-18(14,17)12-17)20-21(5,6)16(2,3)4/h14-15H,7-12H2,1-6H3/t14-,15-,17+,18+/m0/s1 |
| InChIKey | VLFCJCQAUPERSP-CWLKWCNXSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|