C22H26Cl2N4O2 — CID 111310152
N-cyclopropyl-2-[3-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111310152) has the molecular formula C22H26Cl2N4O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[3-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111310152 |
| Molecular Formula | C22H26Cl2N4O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-cyclopropyl-2-[3-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | C/N=C(\NCc1cccc(OCC(=O)NC2CC2)c1)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H26Cl2N4O2/c1-14(19-9-6-16(23)11-20(19)24)27-22(25-2)26-12-15-4-3-5-18(10-15)30-13-21(29)28-17-7-8-17/h3-6,9-11,14,17H,7-8,12-13H2,1-2H3,(H,28,29)(H2,25,26,27) |
| InChIKey | LXKUMZHVMCCTMZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|