C19H34O4 — CID 11131219
(2R,6R)-6-tert-butylperoxy-6-methyl-2-nonylpyran-3-one (PubChem CID 11131219) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2R,6R)-6-tert-butylperoxy-6-methyl-2-nonylpyran-3-one.
| Compound Name | (2R,6R)-6-tert-butylperoxy-6-methyl-2-nonylpyran-3-one |
|---|---|
| PubChem CID | 11131219 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2R,6R)-6-tert-butylperoxy-6-methyl-2-nonylpyran-3-one |
| SMILES | CCCCCCCCC[C@H]1O[C@](C)(OOC(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C19H34O4/c1-6-7-8-9-10-11-12-13-17-16(20)14-15-19(5,21-17)23-22-18(2,3)4/h14-15,17H,6-13H2,1-5H3/t17-,19-/m1/s1 |
| InChIKey | MUMIHPOBZVBCDZ-IEBWSBKVSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|