C21H27FN6O2 — CID 111312448
2-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide (PubChem CID 111312448) has the molecular formula C21H27FN6O2 and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111312448 |
| Molecular Formula | C21H27FN6O2 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cccnc1)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H27FN6O2/c1-23-21(26-15-20(29)27-18-3-2-8-24-13-18)25-14-19(28-9-11-30-12-10-28)16-4-6-17(22)7-5-16/h2-8,13,19H,9-12,14-15H2,1H3,(H,27,29)(H2,23,25,26) |
| InChIKey | JSQCJTSMOIHHDM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|