C16H31N5O2 — CID 111314956
N,N-dimethyl-2-[[[(2-methyl-2-morpholin-4-ylpropyl)amino]-(prop-2-enylamino)methylidene]amino]acetamide (PubChem CID 111314956) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(2-methyl-2-morpholin-4-ylpropyl)amino]-(prop-2-enylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(2-methyl-2-morpholin-4-ylpropyl)amino]-(prop-2-enylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111314956 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N,N-dimethyl-2-[[[(2-methyl-2-morpholin-4-ylpropyl)amino]-(prop-2-enylamino)methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H31N5O2/c1-6-7-17-15(18-12-14(22)20(4)5)19-13-16(2,3)21-8-10-23-11-9-21/h6H,1,7-13H2,2-5H3,(H2,17,18,19) |
| InChIKey | VLERZUPLBAHRCQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|