C19H29N5O3 — CID 111315834
1-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine (PubChem CID 111315834) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111315834 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C19H29N5O3/c1-4-9-20-18(21-14-16-5-7-17(8-6-16)24(25)26)22-15-19(2,3)23-10-12-27-13-11-23/h4-8H,1,9-15H2,2-3H3,(H2,20,21,22) |
| InChIKey | GXFJDSISWCQOAW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|