C19H34IN5O2 — CID 111315787
2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111315787) has the molecular formula C19H34IN5O2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111315787 |
| Molecular Formula | C19H34IN5O2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC(C)C)nc1)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C19H33N5O2.HI/c1-15(2)26-17-7-6-16(12-21-17)13-22-18(20-5)23-14-19(3,4)24-8-10-25-11-9-24;/h6-7,12,15H,8-11,13-14H2,1-5H3,(H2,20,22,23);1H |
| InChIKey | FIHHQOHWNMGNIE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|