C22H27ClN4O — CID 111319782
1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111319782) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111319782 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(CN2CCCC2=O)c1)NC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN4O/c1-16(19-8-10-20(23)11-9-19)26-22(24-2)25-14-17-5-3-6-18(13-17)15-27-12-4-7-21(27)28/h3,5-6,8-11,13,16H,4,7,12,14-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | QBWVIZAIPNKUTB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|