C17H20ClIN4O2 — CID 111319819
1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111319819) has the molecular formula C17H20ClIN4O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111319819 |
| Molecular Formula | C17H20ClIN4O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethyl]-2-methyl-3-[(3-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc([N+](=O)[O-])c1)NC(C)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H19ClN4O2.HI/c1-12(14-6-8-15(18)9-7-14)21-17(19-2)20-11-13-4-3-5-16(10-13)22(23)24;/h3-10,12H,11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | YNKPGMPRLUJPFC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|