C18H31N5O2S — CID 111320490
2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111320490) has the molecular formula C18H31N5O2S and a molecular weight of 381.55 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111320490 |
| Molecular Formula | C18H31N5O2S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-piperidin-1-ylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C18H31N5O2S/c1-18(2,23-10-5-4-6-11-23)14-22-17(20-3)21-13-15-8-7-9-16(12-15)26(19,24)25/h7-9,12H,4-6,10-11,13-14H2,1-3H3,(H2,19,24,25)(H2,20,21,22) |
| InChIKey | XUUXBUODOICNGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|