C23H40N6O — CID 111320918
N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111320918) has the molecular formula C23H40N6O and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111320918 |
| Molecular Formula | C23H40N6O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCCN(C)C)c1)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C23H40N6O/c1-23(2,29-13-7-6-8-14-29)18-27-22(24-3)26-17-19-10-9-11-20(16-19)21(30)25-12-15-28(4)5/h9-11,16H,6-8,12-15,17-18H2,1-5H3,(H,25,30)(H2,24,26,27) |
| InChIKey | KWNLVJSJFYHEPP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|