C21H30O3S — CID 11132209
(5R,8S)-8a-hydroxy-1-methoxy-5-methyl-3-phenylsulfanyl-8-propan-2-yl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one (PubChem CID 11132209) has the molecular formula C21H30O3S and a molecular weight of 362.54 g/mol. Its IUPAC name is (5R,8S)-8a-hydroxy-1-methoxy-5-methyl-3-phenylsulfanyl-8-propan-2-yl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one.
| Compound Name | (5R,8S)-8a-hydroxy-1-methoxy-5-methyl-3-phenylsulfanyl-8-propan-2-yl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 11132209 |
| Molecular Formula | C21H30O3S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (5R,8S)-8a-hydroxy-1-methoxy-5-methyl-3-phenylsulfanyl-8-propan-2-yl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one |
| SMILES | COC1C(=O)C(Sc2ccccc2)CC2[C@H](C)CC[C@@H](C(C)C)C12O |
| InChI | InChI=1S/C21H30O3S/c1-13(2)16-11-10-14(3)17-12-18(25-15-8-6-5-7-9-15)19(22)20(24-4)21(16,17)23/h5-9,13-14,16-18,20,23H,10-12H2,1-4H3/t14-,16+,17?,18?,20?,21?/m1/s1 |
| InChIKey | BFNNTPJSBSODOK-NLFCBUBHSA-N |
| XLogP | 4.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |