C16H20O2S — CID 12678729
8a-hydroxy-3-phenylsulfanyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one (PubChem CID 12678729) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 8a-hydroxy-3-phenylsulfanyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one.
| Compound Name | 8a-hydroxy-3-phenylsulfanyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 12678729 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 8a-hydroxy-3-phenylsulfanyl-1,3,4,4a,5,6,7,8-octahydronaphthalen-2-one |
| SMILES | O=C1CC2(O)CCCCC2CC1Sc1ccccc1 |
| InChI | InChI=1S/C16H20O2S/c17-14-11-16(18)9-5-4-6-12(16)10-15(14)19-13-7-2-1-3-8-13/h1-3,7-8,12,15,18H,4-6,9-11H2 |
| InChIKey | KACYMEPRUPFJGF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |