C16H20O4S — CID 102058085
(4R,4aR,8aR)-4-(benzenesulfonyl)-8a-hydroxy-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one (PubChem CID 102058085) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is (4R,4aR,8aR)-4-(benzenesulfonyl)-8a-hydroxy-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one.
| Compound Name | (4R,4aR,8aR)-4-(benzenesulfonyl)-8a-hydroxy-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 102058085 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (4R,4aR,8aR)-4-(benzenesulfonyl)-8a-hydroxy-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
| SMILES | O=C1CC[C@@H](S(=O)(=O)c2ccccc2)[C@@H]2CCCC[C@]12O |
| InChI | InChI=1S/C16H20O4S/c17-15-10-9-14(13-8-4-5-11-16(13,15)18)21(19,20)12-6-2-1-3-7-12/h1-3,6-7,13-14,18H,4-5,8-11H2/t13-,14+,16+/m0/s1 |
| InChIKey | OPKVYCKNECHPFX-SQWLQELKSA-N |
| XLogP | 2.11 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |