C21H29N5 — CID 111326488
2-methyl-1-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-(2-pyridin-3-ylethyl)guanidine (PubChem CID 111326488) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 2-methyl-1-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-(2-pyridin-3-ylethyl)guanidine.
| Compound Name | 2-methyl-1-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-(2-pyridin-3-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326488 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-methyl-1-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-(2-pyridin-3-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccnc1)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C21H29N5/c1-22-21(24-13-11-18-8-7-12-23-16-18)25-17-20(26-14-5-6-15-26)19-9-3-2-4-10-19/h2-4,7-10,12,16,20H,5-6,11,13-15,17H2,1H3,(H2,22,24,25) |
| InChIKey | LJQHXOLOYVAKRE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|