C22H41IN6 — CID 111330779
1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111330779) has the molecular formula C22H41IN6 and a molecular weight of 516.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111330779 |
| Molecular Formula | C22H41IN6 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCN(C)CC1)NCCN(CC)c1cccc(C)c1.I |
| InChI | InChI=1S/C22H40N6.HI/c1-5-23-22(24-11-15-27-14-8-13-26(4)17-18-27)25-12-16-28(6-2)21-10-7-9-20(3)19-21;/h7,9-10,19H,5-6,8,11-18H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | GZUJFXCFNPIFHY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|