C19H31IN6O — CID 111330421
1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 111330421) has the molecular formula C19H31IN6O and a molecular weight of 486.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111330421 |
| Molecular Formula | C19H31IN6O |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-ethyl-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C)no1)NCCN(CC)c1cccc(C)c1.I |
| InChI | InChI=1S/C19H30N6O.HI/c1-5-20-19(21-11-10-18-23-16(4)24-26-18)22-12-13-25(6-2)17-9-7-8-15(3)14-17;/h7-9,14H,5-6,10-13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | XQEZEFBXMFOPDQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|