C18H31N5O — CID 111330894
N-[2-[[ethylamino-[2-(N-ethyl-3-methylanilino)ethylamino]methylidene]amino]ethyl]acetamide (PubChem CID 111330894) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N-[2-[[ethylamino-[2-(N-ethyl-3-methylanilino)ethylamino]methylidene]amino]ethyl]acetamide.
| Compound Name | N-[2-[[ethylamino-[2-(N-ethyl-3-methylanilino)ethylamino]methylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111330894 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-[2-[[ethylamino-[2-(N-ethyl-3-methylanilino)ethylamino]methylidene]amino]ethyl]acetamide |
| SMILES | CCN/C(=N\CCNC(C)=O)NCCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C18H31N5O/c1-5-19-18(21-11-10-20-16(4)24)22-12-13-23(6-2)17-9-7-8-15(3)14-17/h7-9,14H,5-6,10-13H2,1-4H3,(H,20,24)(H2,19,21,22) |
| InChIKey | CMTVRBBMWXKWIP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|