C23H32O4Si — CID 11133141
4,6-ditert-butyl-4'-methyl-3'-trimethylsilylspiro[1-benzofuran-2,5'-furan]-2',3-dione (PubChem CID 11133141) has the molecular formula C23H32O4Si and a molecular weight of 400.59 g/mol. Its IUPAC name is 4,6-ditert-butyl-4'-methyl-3'-trimethylsilylspiro[1-benzofuran-2,5'-furan]-2',3-dione.
| Compound Name | 4,6-ditert-butyl-4'-methyl-3'-trimethylsilylspiro[1-benzofuran-2,5'-furan]-2',3-dione |
|---|---|
| PubChem CID | 11133141 |
| Molecular Formula | C23H32O4Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4,6-ditert-butyl-4'-methyl-3'-trimethylsilylspiro[1-benzofuran-2,5'-furan]-2',3-dione |
| SMILES | CC1=C([Si](C)(C)C)C(=O)OC12Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1C2=O |
| InChI | InChI=1S/C23H32O4Si/c1-13-18(28(8,9)10)20(25)27-23(13)19(24)17-15(22(5,6)7)11-14(21(2,3)4)12-16(17)26-23/h11-12H,1-10H3 |
| InChIKey | WIIXMLRULGVWFJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|