C14H23F4N3O2 — CID 111335675
N-(4-hydroxycyclohexyl)-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide (PubChem CID 111335675) has the molecular formula C14H23F4N3O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 111335675 |
| Molecular Formula | C14H23F4N3O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-4-(2,2,3,3-tetrafluoropropyl)piperazine-1-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C14H23F4N3O2/c15-12(16)14(17,18)9-20-5-7-21(8-6-20)13(23)19-10-1-3-11(22)4-2-10/h10-12,22H,1-9H2,(H,19,23) |
| InChIKey | BSBVHGMIDJJRRT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|