C11H21Cl2F4N3O — CID 119887927
2-amino-2-methyl-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]propan-1-one;dihydrochloride (PubChem CID 119887927) has the molecular formula C11H21Cl2F4N3O and a molecular weight of 358.21 g/mol. Its IUPAC name is 2-amino-2-methyl-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 2-amino-2-methyl-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119887927 |
| Molecular Formula | C11H21Cl2F4N3O |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-amino-2-methyl-1-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]propan-1-one;dihydrochloride |
| SMILES | CC(C)(N)C(=O)N1CCN(CC(F)(F)C(F)F)CC1.Cl.Cl |
| InChI | InChI=1S/C11H19F4N3O.2ClH/c1-10(2,16)9(19)18-5-3-17(4-6-18)7-11(14,15)8(12)13;;/h8H,3-7,16H2,1-2H3;2*1H |
| InChIKey | JYDNGSVXDMCIAA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|