C26H34IN5O2 — CID 111346964
2-[[ethylamino-[[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 111346964) has the molecular formula C26H34IN5O2 and a molecular weight of 575.50 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111346964 |
| Molecular Formula | C26H34IN5O2 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-[[ethylamino-[[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\NCC)NCC(c2cccc(OC)c2)N2CCCC2)c1.I |
| InChI | InChI=1S/C26H33N5O2.HI/c1-4-20-10-8-12-22(16-20)30-25(32)19-29-26(27-5-2)28-18-24(31-14-6-7-15-31)21-11-9-13-23(17-21)33-3;/h1,8-13,16-17,24H,5-7,14-15,18-19H2,2-3H3,(H,30,32)(H2,27,28,29);1H |
| InChIKey | UOFYCQSINHAQHN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|