C11H19N3S — CID 111350272
3-ethyl-1,1-dimethyl-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111350272) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 3-ethyl-1,1-dimethyl-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111350272 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N/CCc1cccs1)N(C)C |
| InChI | InChI=1S/C11H19N3S/c1-4-12-11(14(2)3)13-8-7-10-6-5-9-15-10/h5-6,9H,4,7-8H2,1-3H3,(H,12,13) |
| InChIKey | YROASHFHTVFQSG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|