C24H33N7O — CID 111352052
2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111352052) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111352052 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[[6-(2-methylmorpholin-4-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1ccc(N2CCOC(C)C2)nc1 |
| InChI | InChI=1S/C24H33N7O/c1-18-17-30(13-14-32-18)23-10-9-20(15-27-23)16-28-24(25-3)26-11-6-12-31-19(2)29-21-7-4-5-8-22(21)31/h4-5,7-10,15,18H,6,11-14,16-17H2,1-3H3,(H2,25,26,28) |
| InChIKey | JVCLYNWDMKOTRH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|