C25H30IN3O — CID 111357155
1-(2,2-diphenylethyl)-3-ethyl-2-[[2-(hydroxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111357155) has the molecular formula C25H30IN3O and a molecular weight of 515.44 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-ethyl-2-[[2-(hydroxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[[2-(hydroxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111357155 |
| Molecular Formula | C25H30IN3O |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[[2-(hydroxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CO)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C25H29N3O.HI/c1-2-26-25(27-17-22-15-9-10-16-23(22)19-29)28-18-24(20-11-5-3-6-12-20)21-13-7-4-8-14-21;/h3-16,24,29H,2,17-19H2,1H3,(H2,26,27,28);1H |
| InChIKey | OUGFGNBFPXLOQA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|