C38H31NO4S — CID 11135740
methyl 4-[4-[1-(trityloxymethyl)cyclopropyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate (PubChem CID 11135740) has the molecular formula C38H31NO4S and a molecular weight of 597.74 g/mol. Its IUPAC name is methyl 4-[4-[1-(trityloxymethyl)cyclopropyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[1-(trityloxymethyl)cyclopropyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11135740 |
| Molecular Formula | C38H31NO4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | methyl 4-[4-[1-(trityloxymethyl)cyclopropyl]phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Oc3ccc(C4(COC(c5ccccc5)(c5ccccc5)c5ccccc5)CC4)cc3)cncc2s1 |
| InChI | InChI=1S/C38H31NO4S/c1-41-36(40)34-23-32-33(24-39-25-35(32)44-34)43-31-19-17-27(18-20-31)37(21-22-37)26-42-38(28-11-5-2-6-12-28,29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,23-25H,21-22,26H2,1H3 |
| InChIKey | VBNPQJUNHFRVBA-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|