C16H13BN2O4S — CID 20594279
methyl 4-[4-(oxoboranylmethylamino)phenoxy]thieno[2,3-c]pyridine-2-carboxylate (PubChem CID 20594279) has the molecular formula C16H13BN2O4S and a molecular weight of 340.17 g/mol. Its IUPAC name is methyl 4-[4-(oxoboranylmethylamino)phenoxy]thieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-(oxoboranylmethylamino)phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20594279 |
| Molecular Formula | C16H13BN2O4S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl 4-[4-(oxoboranylmethylamino)phenoxy]thieno[2,3-c]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Oc3ccc(NCB=O)cc3)cncc2s1 |
| InChI | InChI=1S/C16H13BN2O4S/c1-22-16(20)14-6-12-13(7-18-8-15(12)24-14)23-11-4-2-10(3-5-11)19-9-17-21/h2-8,19H,9H2,1H3 |
| InChIKey | WETBTCOSVOKNJD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|