C13H9N3O2S — CID 18516131
4-pyridin-3-yloxythieno[2,3-c]pyridine-2-carboxamide (PubChem CID 18516131) has the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 4-pyridin-3-yloxythieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-pyridin-3-yloxythieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 18516131 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-pyridin-3-yloxythieno[2,3-c]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc2c(Oc3cccnc3)cncc2s1 |
| InChI | InChI=1S/C13H9N3O2S/c14-13(17)11-4-9-10(6-16-7-12(9)19-11)18-8-2-1-3-15-5-8/h1-7H,(H2,14,17) |
| InChIKey | LMDMSEBLRSJRSE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |