C17H14N2O4S — CID 10154441
ethyl 4-(2-carbamoylthieno[2,3-c]pyridin-4-yl)oxybenzoate (PubChem CID 10154441) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is ethyl 4-(2-carbamoylthieno[2,3-c]pyridin-4-yl)oxybenzoate.
| Compound Name | ethyl 4-(2-carbamoylthieno[2,3-c]pyridin-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 10154441 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | ethyl 4-(2-carbamoylthieno[2,3-c]pyridin-4-yl)oxybenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2cncc3sc(C(N)=O)cc23)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-2-22-17(21)10-3-5-11(6-4-10)23-13-8-19-9-15-12(13)7-14(24-15)16(18)20/h3-9H,2H2,1H3,(H2,18,20) |
| InChIKey | PLJNYURYMQTAIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |