C17H16N2O2S — CID 20594232
4-(1-hydroxy-1-phenylpropyl)thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 20594232) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-(1-hydroxy-1-phenylpropyl)thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-(1-hydroxy-1-phenylpropyl)thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 20594232 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-(1-hydroxy-1-phenylpropyl)thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CCC(O)(c1ccccc1)c1cncc2sc(C(N)=O)cc12 |
| InChI | InChI=1S/C17H16N2O2S/c1-2-17(21,11-6-4-3-5-7-11)13-9-19-10-15-12(13)8-14(22-15)16(18)20/h3-10,21H,2H2,1H3,(H2,18,20) |
| InChIKey | LSSWTMAUGUESOT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |