C17H12BrNO3S — CID 18516199
methyl (E)-3-[4-(4-bromophenoxy)thieno[2,3-c]pyridin-2-yl]prop-2-enoate (PubChem CID 18516199) has the molecular formula C17H12BrNO3S and a molecular weight of 390.26 g/mol. Its IUPAC name is methyl (E)-3-[4-(4-bromophenoxy)thieno[2,3-c]pyridin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(4-bromophenoxy)thieno[2,3-c]pyridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 18516199 |
| Molecular Formula | C17H12BrNO3S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | methyl (E)-3-[4-(4-bromophenoxy)thieno[2,3-c]pyridin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc2c(Oc3ccc(Br)cc3)cncc2s1 |
| InChI | InChI=1S/C17H12BrNO3S/c1-21-17(20)7-6-13-8-14-15(9-19-10-16(14)23-13)22-12-4-2-11(18)3-5-12/h2-10H,1H3/b7-6+ |
| InChIKey | IYTXQIXOKDIBRP-VOTSOKGWSA-N |
| XLogP | 5.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|