C16H15NO4S — CID 142031522
[4-[4-(hydroxymethyl)phenoxy]thieno[2,3-c]pyridin-2-yl]-methoxymethanol (PubChem CID 142031522) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is [4-[4-(hydroxymethyl)phenoxy]thieno[2,3-c]pyridin-2-yl]-methoxymethanol.
| Compound Name | [4-[4-(hydroxymethyl)phenoxy]thieno[2,3-c]pyridin-2-yl]-methoxymethanol |
|---|---|
| PubChem CID | 142031522 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [4-[4-(hydroxymethyl)phenoxy]thieno[2,3-c]pyridin-2-yl]-methoxymethanol |
| SMILES | COC(O)c1cc2c(Oc3ccc(CO)cc3)cncc2s1 |
| InChI | InChI=1S/C16H15NO4S/c1-20-16(19)14-6-12-13(7-17-8-15(12)22-14)21-11-4-2-10(9-18)3-5-11/h2-8,16,18-19H,9H2,1H3 |
| InChIKey | MVRRLCMDAVRWCJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|