C34H57NO6Si — CID 11135789
(2S,5S,6R,10R,11S)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione (PubChem CID 11135789) has the molecular formula C34H57NO6Si and a molecular weight of 603.92 g/mol. Its IUPAC name is (2S,5S,6R,10R,11S)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione.
| Compound Name | (2S,5S,6R,10R,11S)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
|---|---|
| PubChem CID | 11135789 |
| Molecular Formula | C34H57NO6Si |
| Molecular Weight | 603.92 g/mol |
| Exact Mass | 603.40 |
| IUPAC Name | (2S,5S,6R,10R,11S)-5-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
| SMILES | CCCCCCC[C@H]1OC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)OC(=O)[C@H]1C |
| InChI | InChI=1S/C34H57NO6Si/c1-11-12-13-14-18-21-28-25(4)33(38)40-31(24(2)3)32(37)35(8)27(22-26-19-16-15-17-20-26)29(23-30(36)39-28)41-42(9,10)34(5,6)7/h15-17,19-20,24-25,27-29,31H,11-14,18,21-23H2,1-10H3/t25-,27-,28+,29+,31-/m0/s1 |
| InChIKey | OYSYWBZAOLCSGJ-PHURAUOSSA-N |
| XLogP | 7.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.92 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|