C22H32N4O2S — CID 111359382
2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(2-methylphenyl)methyl]guanidine (PubChem CID 111359382) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(2-methylphenyl)methyl]guanidine.
| Compound Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(2-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111359382 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(2-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)NC(C)(C)C)NCc1ccccc1C |
| InChI | InChI=1S/C22H32N4O2S/c1-6-23-21(24-15-18-12-8-7-11-17(18)2)25-16-19-13-9-10-14-20(19)29(27,28)26-22(3,4)5/h7-14,26H,6,15-16H2,1-5H3,(H2,23,24,25) |
| InChIKey | LDKMQCAFCOGPMS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|