C22H32N4O3S — CID 111004833
2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine (PubChem CID 111004833) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine.
| Compound Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine |
|---|---|
| PubChem CID | 111004833 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)NC(C)(C)C)NCCOc1ccccc1 |
| InChI | InChI=1S/C22H32N4O3S/c1-5-23-21(24-15-16-29-19-12-7-6-8-13-19)25-17-18-11-9-10-14-20(18)30(27,28)26-22(2,3)4/h6-14,26H,5,15-17H2,1-4H3,(H2,23,24,25) |
| InChIKey | GBGGQAFAMCOGKC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|