C18H32N4O3S — CID 111234893
2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine (PubChem CID 111234893) has the molecular formula C18H32N4O3S and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111234893 |
| Molecular Formula | C18H32N4O3S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)NC(C)(C)C)NC(C)COC |
| InChI | InChI=1S/C18H32N4O3S/c1-7-19-17(21-14(2)13-25-6)20-12-15-10-8-9-11-16(15)26(23,24)22-18(3,4)5/h8-11,14,22H,7,12-13H2,1-6H3,(H2,19,20,21) |
| InChIKey | VDGOCGSXHTUXAM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|