C20H35N5O3S — CID 111383381
N-tert-butyl-2-[[N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide (PubChem CID 111383381) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383381 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-tert-butyl-2-[[N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)NC(C)(C)C)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H35N5O3S/c1-8-21-18(23-14-17(26)24-19(2,3)4)22-13-15-11-9-10-12-16(15)29(27,28)25-20(5,6)7/h9-12,25H,8,13-14H2,1-7H3,(H,24,26)(H2,21,22,23) |
| InChIKey | KOTVWCJWHCEJFK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|