C44H40IN5O8 — CID 11136700
tetrakis[3-(1,3-dioxoisoindol-2-yl)propyl]azanium iodide (PubChem CID 11136700) has the molecular formula C44H40IN5O8 and a molecular weight of 893.74 g/mol. Its IUPAC name is tetrakis[3-(1,3-dioxoisoindol-2-yl)propyl]azanium iodide.
| Compound Name | tetrakis[3-(1,3-dioxoisoindol-2-yl)propyl]azanium iodide |
|---|---|
| PubChem CID | 11136700 |
| Molecular Formula | C44H40IN5O8 |
| Molecular Weight | 893.74 g/mol |
| Exact Mass | 893.19 |
| IUPAC Name | tetrakis[3-(1,3-dioxoisoindol-2-yl)propyl]azanium iodide |
| SMILES | O=C1c2ccccc2C(=O)N1CCC[N+](CCCN1C(=O)c2ccccc2C1=O)(CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O.[I-] |
| InChI | InChI=1S/C44H40N5O8.HI/c50-37-29-13-1-2-14-30(29)38(51)45(37)21-9-25-49(26-10-22-46-39(52)31-15-3-4-16-32(31)40(46)53,27-11-23-47-41(54)33-17-5-6-18-34(33)42(47)55)28-12-24-48-43(56)35-19-7-8-20-36(35)44(48)57;/h1-8,13-20H,9-12,21-28H2;1H/q+1;/p-1 |
| InChIKey | FYXZGFDHUBMPOW-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|