C19H29N5O2 — CID 111367293
3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 111367293) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111367293 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 3-ethyl-2-(2-hydroxy-3-phenylmethoxypropyl)-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)COCc1ccccc1)N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C19H29N5O2/c1-4-20-19(23(2)12-17-10-22-24(3)13-17)21-11-18(25)15-26-14-16-8-6-5-7-9-16/h5-10,13,18,25H,4,11-12,14-15H2,1-3H3,(H,20,21) |
| InChIKey | DRIOEDVWXDLEKV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|