C21H28F2IN3O2 — CID 111288262
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide (PubChem CID 111288262) has the molecular formula C21H28F2IN3O2 and a molecular weight of 519.37 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288262 |
| Molecular Formula | C21H28F2IN3O2 |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-2-(2-hydroxy-3-phenylpropyl)-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)Cc1ccccc1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C21H27F2N3O2.HI/c1-3-24-21(25-14-18(27)13-16-7-5-4-6-8-16)26(2)15-17-9-11-19(12-10-17)28-20(22)23;/h4-12,18,20,27H,3,13-15H2,1-2H3,(H,24,25);1H |
| InChIKey | ZFQWDGPQJNOINM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|