C21H44N6O — CID 111368509
1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine (PubChem CID 111368509) has the molecular formula C21H44N6O and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111368509 |
| Molecular Formula | C21H44N6O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | 1-ethyl-2-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)CN1CCN(C)CC1)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C21H44N6O/c1-6-22-21(23-13-19(4)16-26-9-7-25(5)8-10-26)24-14-20-17-27(11-12-28-20)15-18(2)3/h18-20H,6-17H2,1-5H3,(H2,22,23,24) |
| InChIKey | HQAJLWAPFUOOLW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|