C19H33N5O2S — CID 111370199
1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111370199) has the molecular formula C19H33N5O2S and a molecular weight of 395.57 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111370199 |
| Molecular Formula | C19H33N5O2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H33N5O2S/c1-17-9-6-7-15-24(17)16-8-12-21-19(20-2)22-13-14-23-27(25,26)18-10-4-3-5-11-18/h3-5,10-11,17,23H,6-9,12-16H2,1-2H3,(H2,20,21,22) |
| InChIKey | DGQFQHPZYIXRPN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|